* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-PHENYL-5,6,7,8-TETRAHYDRO-PYRIDO[4,3-E][1,2,4]TRIAZINE |
CAS: | 741737-42-8 |
English Synonyms: | 3-PHENYL-5,6,7,8-TETRAHYDRO-PYRIDO[4,3-E][1,2,4]TRIAZINE |
MDL Number.: | MFCD11847863 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)c2nc3c(nn2)CNCC3 |
InChi: | InChI=1S/C12H12N4/c1-2-4-9(5-3-1)12-14-10-6-7-13-8-11(10)15-16-12/h1-5,13H,6-8H2 |
InChiKey: | InChIKey=OOLIIPWLWOPDGF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.