* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-CHLORO-1,2,3,4-TETRAHYDRO-6-NITRO-ACRIDINE |
CAS: | 286438-37-7 |
English Synonyms: | 9-CHLORO-1,2,3,4-TETRAHYDRO-6-NITRO-ACRIDINE |
MDL Number.: | MFCD11849280 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1cc2c(cc1[N+](=O)[O-])nc3c(c2Cl)CCCC3 |
InChi: | InChI=1S/C13H11ClN2O2/c14-13-9-3-1-2-4-11(9)15-12-7-8(16(17)18)5-6-10(12)13/h5-7H,1-4H2 |
InChiKey: | InChIKey=UNGZTFAWTHSZIV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.