* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB016567 |
| English Synonyms: | VITAS-BB TBB016567 |
| MDL Number.: | MFCD11853830 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | COC1=CC=C(CC(=O)N\N=C/C2=C(O)C=CC(=C2)[N+]([O-])=O)C=C1 |
| InChi: | InChI=1S/C16H15N3O5/c1-24-14-5-2-11(3-6-14)8-16(21)18-17-10-12-9-13(19(22)23)4-7-15(12)20/h2-7,9-10,20H,8H2,1H3,(H,18,21)/b17-10- |
| InChiKey: | InChIKey=ZKFQSSZSFVHFIU-YVLHZVERSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.