* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-((2R)PYRROLIDIN-2-YL)-5,6,7,8-TETRAHYDROACRIDINE |
English Synonyms: | 9-((2R)PYRROLIDIN-2-YL)-5,6,7,8-TETRAHYDROACRIDINE |
MDL Number.: | MFCD11864184 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c(c3c(n2)CCCC3)[C@H]4CCCN4 |
InChi: | InChI=1S/C17H20N2/c1-3-8-14-12(6-1)17(16-10-5-11-18-16)13-7-2-4-9-15(13)19-14/h1,3,6,8,16,18H,2,4-5,7,9-11H2/t16-/m1/s1 |
InChiKey: | InChIKey=DJJXXDAABGGLKV-MRXNPFEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.