* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-((2S)-2-PIPERIDYL)-1,2,3-TRIHYDROCYCLOPENTA[2,1-B]QUINOLINE |
| English Synonyms: | 9-((2S)-2-PIPERIDYL)-1,2,3-TRIHYDROCYCLOPENTA[2,1-B]QUINOLINE |
| MDL Number.: | MFCD11864585 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)c(c3c(n2)CCC3)[C@@H]4CCCCN4 |
| InChi: | InChI=1S/C17H20N2/c1-2-8-14-12(6-1)17(16-9-3-4-11-18-16)13-7-5-10-15(13)19-14/h1-2,6,8,16,18H,3-5,7,9-11H2/t16-/m0/s1 |
| InChiKey: | InChIKey=BMKRCDDHFMUXAV-INIZCTEOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.