* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KT5720 |
| CAS: | 108068-98-0 |
| English Synonyms: | 2,3,9,10,11,12-HEXAHYDRO-10S-HYDROXY-9-METHYL-1-OXO-9R,12S-EPOXY-1H-DIINDOLO[1,2,3-FG:3',2',1'-KL]PYRROLO[3,4-I][1,6]BENZODIAZOCINE-10-CARBOXYLIC ACID, HEXYL ESTER ; KT5720 |
| MDL Number.: | MFCD11867895 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCCCCCOC(=O)[C@@]1(C[C@H]2n3c4ccccc4c5c3c6c(c7ccccc7n6[C@@]1(O2)C)c8c5C(=O)NC8)O |
| InChi: | InChI=1S/C32H31N3O5/c1-3-4-5-10-15-39-30(37)32(38)16-23-34-21-13-8-6-11-18(21)25-26-20(17-33-29(26)36)24-19-12-7-9-14-22(19)35(28(24)27(25)34)31(32,2)40-23/h6-9,11-14,23,38H,3-5,10,15-17H2,1-2H3,(H,33,36)/t23-,31+,32+/m0/s1 |
| InChiKey: | InChIKey=ZHEHVZXPFVXKEY-RUAOOFDTSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.