* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DECANE-2,4-DIOL |
CAS: | 24892-56-6 |
English Synonyms: | DECANE-2,4-DIOL ; 2,4-DIHYDROXYDECANE |
MDL Number.: | MFCD11869734 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CCCCCCC(CC(C)O)O |
InChi: | InChI=1S/C10H22O2/c1-3-4-5-6-7-10(12)8-9(2)11/h9-12H,3-8H2,1-2H3 |
InChiKey: | InChIKey=AMJXRWSHIASCAM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.