* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HONGHUI-MED 480120000000 |
English Synonyms: | HONGHUI-MED 480120000000 |
MDL Number.: | MFCD11870885 |
H bond acceptor: | 8 |
H bond donor: | 0 |
Smile: | CCCCCCC(CCCCCC)N1C(=O)c2ccc3c4c(cc5c6c4c(ccc6C(=O)N(C5=O)C(CCCCCC)CCCCCC)c7c3c2c(cc7OC)C1=O)OC |
InChi: | InChI=1S/C52H66N2O6/c1-7-11-15-19-23-33(24-20-16-12-8-2)53-49(55)37-29-27-35-46-42(60-6)32-40-44-38(50(56)54(52(40)58)34(25-21-17-13-9-3)26-22-18-14-10-4)30-28-36(48(44)46)45-41(59-5)31-39(51(53)57)43(37)47(35)45/h27-34H,7-26H2,1-6H3 |
InChiKey: | InChIKey=UGIUBGZBOMMALR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.