* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HDH-PHARMA 20382 |
| English Synonyms: | HDH-PHARMA 20382 |
| MDL Number.: | MFCD11871137 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | ClC1=NC(=CC(NCCC2CCNCC2)=N1)C1=CC=CN=C1 |
| InChi: | InChI=1S/C16H20ClN5/c17-16-21-14(13-2-1-6-19-11-13)10-15(22-16)20-9-5-12-3-7-18-8-4-12/h1-2,6,10-12,18H,3-5,7-9H2,(H,20,21,22) |
| InChiKey: | InChIKey=HGITWTIJNYFKHK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.