* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HDH-PHARMA 20570 |
English Synonyms: | HDH-PHARMA 20570 |
MDL Number.: | MFCD11871318 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | FC(F)(F)OC1=CC(=CC=C1)C1=CC(NCC2CCCO2)=NC(Cl)=N1 |
InChi: | InChI=1S/C16H15ClF3N3O2/c17-15-22-13(8-14(23-15)21-9-12-5-2-6-24-12)10-3-1-4-11(7-10)25-16(18,19)20/h1,3-4,7-8,12H,2,5-6,9H2,(H,21,22,23) |
InChiKey: | InChIKey=UIYXAZVIMFYGBM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.