* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HDH-PHARMA 20823 |
English Synonyms: | HDH-PHARMA 20823 |
MDL Number.: | MFCD11871571 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | FC1=CC=C(NC2=NC(Cl)=NC(=C2)C2=CC=CN=C2)C=C1Cl |
InChi: | InChI=1S/C15H9Cl2FN4/c16-11-6-10(3-4-12(11)18)20-14-7-13(21-15(17)22-14)9-2-1-5-19-8-9/h1-8H,(H,20,21,22) |
InChiKey: | InChIKey=ORDMGMZRXFIDLL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.