* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | HDH-PHARMA 21175 |
English Synonyms: | HDH-PHARMA 21175 |
MDL Number.: | MFCD11871916 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | FC(F)(F)C1=CC=C(Cl)C(NC2=NC(Cl)=NC(=C2)C2CC2)=C1 |
InChi: | InChI=1S/C14H10Cl2F3N3/c15-9-4-3-8(14(17,18)19)5-11(9)20-12-6-10(7-1-2-7)21-13(16)22-12/h3-7H,1-2H2,(H,20,21,22) |
InChiKey: | InChIKey=AYIXTDZDUZCYFV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.