* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HDH-PHARMA 21252 |
English Synonyms: | HDH-PHARMA 21252 |
MDL Number.: | MFCD11871993 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | FC1=CC=C(NC2=NC(Cl)=NC(=C2)C2CC2)C=C1C(F)(F)F |
InChi: | InChI=1S/C14H10ClF4N3/c15-13-21-11(7-1-2-7)6-12(22-13)20-8-3-4-10(16)9(5-8)14(17,18)19/h3-7H,1-2H2,(H,20,21,22) |
InChiKey: | InChIKey=KUMDIWLBCRKXSH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.