* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HDH-PHARMA 21274 |
| English Synonyms: | HDH-PHARMA 21274 |
| MDL Number.: | MFCD11872008 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | FC(F)(F)C1=CC=C(NC2=NC(Cl)=NC(=C2)C(F)(F)F)C(Br)=C1 |
| InChi: | InChI=1S/C12H5BrClF6N3/c13-6-3-5(11(15,16)17)1-2-7(6)21-9-4-8(12(18,19)20)22-10(14)23-9/h1-4H,(H,21,22,23) |
| InChiKey: | InChIKey=LLWYXAORSVTKHA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.