* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HDH-PHARMA 21315 |
| English Synonyms: | HDH-PHARMA 21315 |
| MDL Number.: | MFCD11872049 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | ClC1=NC(=CC(NNC2=CC=C(NS(=O)=O)C=C2)=N1)C1CC1 |
| InChi: | InChI=1S/C13H14ClN5O2S/c14-13-15-11(8-1-2-8)7-12(16-13)18-17-9-3-5-10(6-4-9)19-22(20)21/h3-8,17,22H,1-2H2,(H,15,16,18)(H,19,20,21) |
| InChiKey: | InChIKey=XOCXOPHMBPJTDP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.