* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HDH-PHARMA 21477 |
English Synonyms: | HDH-PHARMA 21477 |
MDL Number.: | MFCD11872211 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC1=CC=C(NC2=NC(Cl)=NC(=C2)C(F)(F)F)C=C1C(F)(F)F |
InChi: | InChI=1S/C13H8ClF6N3/c1-6-2-3-7(4-8(6)12(15,16)17)21-10-5-9(13(18,19)20)22-11(14)23-10/h2-5H,1H3,(H,21,22,23) |
InChiKey: | InChIKey=LEWJSQCGBADKMX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.