* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HDH-PHARMA 21725 |
English Synonyms: | HDH-PHARMA 21725 |
MDL Number.: | MFCD11872431 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | COC1=C(Cl)C=C(Cl)C(NC2=NC(Cl)=NC(=C2)C2=CC=CC(OC(F)(F)F)=C2)=C1 |
InChi: | InChI=1S/C18H11Cl3F3N3O2/c1-28-15-7-14(11(19)6-12(15)20)25-16-8-13(26-17(21)27-16)9-3-2-4-10(5-9)29-18(22,23)24/h2-8H,1H3,(H,25,26,27) |
InChiKey: | InChIKey=JIIUYUGYVDNOOU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.