* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HDH-PHARMA 22834 |
English Synonyms: | HDH-PHARMA 22834 |
MDL Number.: | MFCD11873131 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | FC(F)(F)SC1=CC(COC2=CC=C(Br)N=C2)=CC=C1Cl |
InChi: | InChI=1S/C13H8BrClF3NOS/c14-12-4-2-9(6-19-12)20-7-8-1-3-10(15)11(5-8)21-13(16,17)18/h1-6H,7H2 |
InChiKey: | InChIKey=WGOPLBJIVZYBBY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.