* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HDH-PHARMA 24558 |
| English Synonyms: | HDH-PHARMA 24558 |
| MDL Number.: | MFCD11874595 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | CC(C)(C)OC(=O)N1CCCC(C1)COCc2ccccc2[N+](=O)[O-] |
| InChi: | InChI=1S/C18H26N2O5/c1-18(2,3)25-17(21)19-10-6-7-14(11-19)12-24-13-15-8-4-5-9-16(15)20(22)23/h4-5,8-9,14H,6-7,10-13H2,1-3H3 |
| InChiKey: | InChIKey=HTDCHZLJNSVCAE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.