* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HDH-PHARMA 25230 |
English Synonyms: | HDH-PHARMA 25230 |
MDL Number.: | MFCD11875069 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CC(C)(C)OC(=O)N1CCCC(C1)COCc2ccc(c(c2)C(F)(F)F)OC |
InChi: | InChI=1S/C20H28F3NO4/c1-19(2,3)28-18(25)24-9-5-6-15(11-24)13-27-12-14-7-8-17(26-4)16(10-14)20(21,22)23/h7-8,10,15H,5-6,9,11-13H2,1-4H3 |
InChiKey: | InChIKey=WFQPDERHEYEDTB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.