* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HDH-PHARMA 25397 |
English Synonyms: | HDH-PHARMA 25397 |
MDL Number.: | MFCD11875208 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | Cc1ccc(c(c1F)F)COCC2CCN(CC2)C(=O)OC(C)(C)C |
InChi: | InChI=1S/C19H27F2NO3/c1-13-5-6-15(17(21)16(13)20)12-24-11-14-7-9-22(10-8-14)18(23)25-19(2,3)4/h5-6,14H,7-12H2,1-4H3 |
InChiKey: | InChIKey=UYWCLAWSOCJFNU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.