* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HDH-PHARMA 25594 |
| English Synonyms: | HDH-PHARMA 25594 |
| MDL Number.: | MFCD11875259 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | FC(F)(F)C1=CC(Cl)=CC(COC2=CC=C(Br)N=C2)=C1 |
| InChi: | InChI=1S/C13H8BrClF3NO/c14-12-2-1-11(6-19-12)20-7-8-3-9(13(16,17)18)5-10(15)4-8/h1-6H,7H2 |
| InChiKey: | InChIKey=RDIKNGQOXSXZLS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.