* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HDH-PHARMA 25470 |
English Synonyms: | HDH-PHARMA 25470 |
MDL Number.: | MFCD11875269 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | Cc1cc(cc(c1F)C)COCC2CCCN(C2)C(=O)OC(C)(C)C |
InChi: | InChI=1S/C20H30FNO3/c1-14-9-17(10-15(2)18(14)21)13-24-12-16-7-6-8-22(11-16)19(23)25-20(3,4)5/h9-10,16H,6-8,11-13H2,1-5H3 |
InChiKey: | InChIKey=WYWKFCGURAYLJI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.