* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HDH-PHARMA 25992 |
English Synonyms: | HDH-PHARMA 25992 |
MDL Number.: | MFCD11875588 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | [H][C@@]12CC[C@@]([H])(N(C1)C1=CC(Cl)=NC=N1)C1=CC=CC=C21 |
InChi: | InChI=1S/C15H14ClN3/c16-14-7-15(18-9-17-14)19-8-10-5-6-13(19)12-4-2-1-3-11(10)12/h1-4,7,9-10,13H,5-6,8H2/t10-,13-/m1/s1 |
InChiKey: | InChIKey=VIILTLGHYVTBQP-ZWNOBZJWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.