* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HDH-PHARMA 26110 |
| English Synonyms: | HDH-PHARMA 26110 |
| MDL Number.: | MFCD11875705 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | [H][C@@]12CC[C@@]([H])(N(C1)C1=NC(Cl)=NC(CC)=C1)C1=CC=CC=C21 |
| InChi: | InChI=1S/C17H18ClN3/c1-2-12-9-16(20-17(18)19-12)21-10-11-7-8-15(21)14-6-4-3-5-13(11)14/h3-6,9,11,15H,2,7-8,10H2,1H3/t11-,15-/m1/s1 |
| InChiKey: | InChIKey=CTENAFVBCIUIOD-IAQYHMDHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.