* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HDH-PHARMA 26114 |
| English Synonyms: | HDH-PHARMA 26114 |
| MDL Number.: | MFCD11875709 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCC1=CC(=NC(Cl)=N1)N1CCC2=C(C1)C=C(OC(F)(F)F)C=C2 |
| InChi: | InChI=1S/C16H15ClF3N3O/c1-2-12-8-14(22-15(17)21-12)23-6-5-10-3-4-13(7-11(10)9-23)24-16(18,19)20/h3-4,7-8H,2,5-6,9H2,1H3 |
| InChiKey: | InChIKey=BGZBWQVKRCYULS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.