* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HDH-PHARMA 26126 |
| English Synonyms: | HDH-PHARMA 26126 |
| MDL Number.: | MFCD11875721 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | [H][C@@]12CC[C@@]([H])(N(C1)C1=NC(Cl)=NC(=C1)C(C)C)C1=CC=CC=C21 |
| InChi: | InChI=1S/C18H20ClN3/c1-11(2)15-9-17(21-18(19)20-15)22-10-12-7-8-16(22)14-6-4-3-5-13(12)14/h3-6,9,11-12,16H,7-8,10H2,1-2H3/t12-,16-/m1/s1 |
| InChiKey: | InChIKey=DTVZSHJUGKJJOJ-MLGOLLRUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.