* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HDH-PHARMA 26131 |
| English Synonyms: | HDH-PHARMA 26131 |
| MDL Number.: | MFCD11875726 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC(C)C1=CC(=NC(Cl)=N1)N1CCC2=C(C1)C=C(C=C2)S(N)(=O)=O |
| InChi: | InChI=1S/C16H19ClN4O2S/c1-10(2)14-8-15(20-16(17)19-14)21-6-5-11-3-4-13(24(18,22)23)7-12(11)9-21/h3-4,7-8,10H,5-6,9H2,1-2H3,(H2,18,22,23) |
| InChiKey: | InChIKey=JPWCEIJIWOXIEL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.