* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HDH-PHARMA 26509 |
| English Synonyms: | HDH-PHARMA 26509 |
| MDL Number.: | MFCD11876003 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CNCC1=CN(C(Br)=C1C(C)C)S(=O)(=O)C1=CC=CC=C1 |
| InChi: | InChI=1S/C15H19BrN2O2S/c1-11(2)14-12(9-17-3)10-18(15(14)16)21(19,20)13-7-5-4-6-8-13/h4-8,10-11,17H,9H2,1-3H3 |
| InChiKey: | InChIKey=LPPKFSGGMPSBOC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.