* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HDH-PHARMA 26513 |
| English Synonyms: | HDH-PHARMA 26513 |
| MDL Number.: | MFCD11876006 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CCC1=C(Br)N(C=C1CN(C)C(=O)OC(C)(C)C)S(=O)(=O)C1=CC=CC=C1 |
| InChi: | InChI=1S/C19H25BrN2O4S/c1-6-16-14(12-21(5)18(23)26-19(2,3)4)13-22(17(16)20)27(24,25)15-10-8-7-9-11-15/h7-11,13H,6,12H2,1-5H3 |
| InChiKey: | InChIKey=ZZASJMJYBAWQOU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.