* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HDH-PHARMA 26516 |
| English Synonyms: | HDH-PHARMA 26516 |
| MDL Number.: | MFCD11876009 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CC(C)C1=C(N(C=C1CN(C)C(=O)OC(C)(C)C)S(=O)(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
| InChi: | InChI=1S/C26H32N2O4S/c1-19(2)23-21(17-27(6)25(29)32-26(3,4)5)18-28(24(23)20-13-9-7-10-14-20)33(30,31)22-15-11-8-12-16-22/h7-16,18-19H,17H2,1-6H3 |
| InChiKey: | InChIKey=ISBJVZYEBVYULU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.