* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HDH-PHARMA 26577 |
| English Synonyms: | HDH-PHARMA 26577 |
| MDL Number.: | MFCD11876069 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | Cl.Cl.CNCC1=CN(C(=C1)C1=CC(N)=CC=C1)S(=O)(=O)C1=CC=C(OC)C=C1 |
| InChi: | InChI=1S/C19H21N3O3S.2ClH/c1-21-12-14-10-19(15-4-3-5-16(20)11-15)22(13-14)26(23,24)18-8-6-17(25-2)7-9-18;;/h3-11,13,21H,12,20H2,1-2H3;2*1H |
| InChiKey: | InChIKey=QXATUCSJXGUIPQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.