* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HDH-PHARMA 26584 |
English Synonyms: | HDH-PHARMA 26584 |
MDL Number.: | MFCD11876076 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cl.CNCC1=CN(C(=C1)C1=CC=CC=C1)S(=O)(=O)C1=CC=CC=C1 |
InChi: | InChI=1S/C18H18N2O2S.ClH/c1-19-13-15-12-18(16-8-4-2-5-9-16)20(14-15)23(21,22)17-10-6-3-7-11-17;/h2-12,14,19H,13H2,1H3;1H |
InChiKey: | InChIKey=BQDPLMSRUBKMDQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.