* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HDH-PHARMA 26056 |
English Synonyms: | HDH-PHARMA 26056 |
MDL Number.: | MFCD11877770 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | B(c1cnc(nc1)OC2CCCNC2)(O)O |
InChi: | InChI=1S/C9H14BN3O3/c14-10(15)7-4-12-9(13-5-7)16-8-2-1-3-11-6-8/h4-5,8,11,14-15H,1-3,6H2 |
InChiKey: | InChIKey=APLNLVJIGBZYAR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.