* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HDH-PHARMA 26060 |
| English Synonyms: | HDH-PHARMA 26060 |
| MDL Number.: | MFCD11877774 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | B(c1cnc(nc1)OCC2CCNCC2)(O)O |
| InChi: | InChI=1S/C10H16BN3O3/c15-11(16)9-5-13-10(14-6-9)17-7-8-1-3-12-4-2-8/h5-6,8,12,15-16H,1-4,7H2 |
| InChiKey: | InChIKey=OPYTWTHMXLXRJW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.