* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HDH-PHARMA 26061 |
| English Synonyms: | HDH-PHARMA 26061 |
| MDL Number.: | MFCD11877775 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | B(c1cnc(nc1)OCC2CCN(CC2)C(=O)OC(C)(C)C)(O)O |
| InChi: | InChI=1S/C15H24BN3O5/c1-15(2,3)24-14(20)19-6-4-11(5-7-19)10-23-13-17-8-12(9-18-13)16(21)22/h8-9,11,21-22H,4-7,10H2,1-3H3 |
| InChiKey: | InChIKey=CFVRGCCPJQPLLO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.