* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GOXALAPLADIB |
| CAS: | 412950-27-7 |
| English Synonyms: | GOXALAPLADIB |
| MDL Number.: | MFCD11973643 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | COCCN1CCC(CC1)N(Cc2ccc(cc2)c3ccc(cc3)C(F)(F)F)C(=O)Cn4c(cc(=O)c5c4nccc5)CCc6ccc(c(c6)F)F |
| InChi: | InChI=1S/C40H39F5N4O3/c1-52-22-21-47-19-16-32(17-20-47)48(25-28-4-8-29(9-5-28)30-10-12-31(13-11-30)40(43,44)45)38(51)26-49-33(14-6-27-7-15-35(41)36(42)23-27)24-37(50)34-3-2-18-46-39(34)49/h2-5,7-13,15,18,23-24,32H,6,14,16-17,19-22,25-26H2,1H3 |
| InChiKey: | InChIKey=ZBUHEOPFXGBZIR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.