* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(4-PHENYLPHENYL)PIPERIDIN-3-OL |
CAS: | 791041-20-8 |
English Synonyms: | 3-(4-PHENYLPHENYL)PIPERIDIN-3-OL ; 3-[1,1'-BIPHENYL]-4-YL-3-PIPERIDINOL |
MDL Number.: | MFCD11974902 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)c2ccc(cc2)C3(CCCNC3)O |
InChi: | InChI=1S/C17H19NO/c19-17(11-4-12-18-13-17)16-9-7-15(8-10-16)14-5-2-1-3-6-14/h1-3,5-10,18-19H,4,11-13H2 |
InChiKey: | InChIKey=NBFFYOOZSIBSKF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.