* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ICARISIDE B5 |
| CAS: | 114226-08-3 |
| English Synonyms: | ICARISIDE B5 |
| MDL Number.: | MFCD11975459 |
| H bond acceptor: | 8 |
| H bond donor: | 5 |
| Smile: | CC1=CC(=O)CC([C@@]1(CC[C@H](C)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)(C)C |
| InChi: | InChI=1S/C19H32O8/c1-10-7-12(21)8-18(3,4)19(10,25)6-5-11(2)26-17-16(24)15(23)14(22)13(9-20)27-17/h7,11,13-17,20,22-25H,5-6,8-9H2,1-4H3/t11-,13+,14+,15-,16+,17+,19-/m0/s1 |
| InChiKey: | InChIKey=CZYPGTRKJFYXLT-APZCKXRDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.