Molecular Structure:
CCD No.:CCD01393028
DOXICALCIFEROL-13C-D3
Formula:C28 H41 D3 O2
MolWeight:416.661
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | DOXICALCIFEROL-13C-D3 |
| English Synonyms： | DOXICALCIFEROL-13C-D3 |
| MDL Number.： | MFCD11977946 |
| H bond acceptor： | 2 |
| H bond donor： | 2 |
| Smile： | CC([13CH3])[C@@H](C)/C=C/[C@@H](C)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](C[C@@H](C3=C)O)O)C |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
