Molecular Structure:
CCD No.:CCD01393069
DARIFENACIN-D4
Formula:C28 H26 D4 N2 O2
MolWeight:430.581
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | DARIFENACIN-D4 |
| English Synonyms： | DARIFENACIN-D4 |
| MDL Number.： | MFCD11977987 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | [2H]C([2H])(c1ccc2c(c1)CCO2)C([2H])([2H])N3CC[C@@H](C3)C(c4ccccc4)(c5ccccc5)C(=O)N |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
