* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IBSCREEN-BB BB_SC-6007 |
| English Synonyms: | IBSCREEN-BB BB_SC-6007 |
| MDL Number.: | MFCD11982934 |
| H bond acceptor: | 4 |
| H bond donor: | 4 |
| Smile: | CC(C)(C)NC[C@@H](c1ccc(c(c1)CO)O)O.OS(=O)(=O)O |
| InChi: | InChI=1S/C13H21NO3.H2O4S/c1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15;1-5(2,3)4/h4-6,12,14-17H,7-8H2,1-3H3;(H2,1,2,3,4)/t12-;/m0./s1 |
| InChiKey: | InChIKey=OVICLFZZVQVVFT-YDALLXLXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.