* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-CIS ACITRETIN |
CAS: | 419534-31-9 |
English Synonyms: | 9-CIS ACITRETIN |
MDL Number.: | MFCD12031377 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1cc(c(c(c1/C=C/C(=C\C=C\C(=C\C(=O)O)\C)/C)C)C)OC |
InChi: | InChI=1S/C21H26O3/c1-14(8-7-9-15(2)12-21(22)23)10-11-19-16(3)13-20(24-6)18(5)17(19)4/h7-13H,1-6H3,(H,22,23)/b9-7+,11-10+,14-8-,15-12+ |
InChiKey: | InChIKey=IHUNBGSDBOWDMA-CJJRUFRZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.