* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-CHLORO-7-PROPYL-2H,3H-[1,4]DIOXINO[2,3-G]QUINOLINE |
English Synonyms: | 9-CHLORO-7-PROPYL-2H,3H-[1,4]DIOXINO[2,3-G]QUINOLINE |
MDL Number.: | MFCD12114904 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CCCc1cc(c2cc3c(cc2n1)OCCO3)Cl |
InChi: | InChI=1S/C14H14ClNO2/c1-2-3-9-6-11(15)10-7-13-14(8-12(10)16-9)18-5-4-17-13/h6-8H,2-5H2,1H3 |
InChiKey: | InChIKey=QNFCIKSSQLMDCU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.