* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-PROPYN-1-OL, 3-(2,4,6-TRIMETHYLPHENYL)- |
CAS: | 774-10-7 |
English Synonyms: | 2-PROPYN-1-OL, 3-(2,4,6-TRIMETHYLPHENYL)- ; 3-(2,4,6-TRIMETHYLPHENYL)-2-PROPYN-1-OL ; 3-(2,4,6-TRIMETHYLPHENYL)PROP-2-YN-1-OL |
MDL Number.: | MFCD12155749 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | Cc1cc(c(c(c1)C)C#CCO)C |
InChi: | InChI=1S/C12H14O/c1-9-7-10(2)12(5-4-6-13)11(3)8-9/h7-8,13H,6H2,1-3H3 |
InChiKey: | InChIKey=IUDAJVZEUIDFQX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.