* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-IODO-2,3,4,5-TETRAHYDRO-1-BENZOXEPIN-5-AMINE |
English Synonyms: | 9-IODO-2,3,4,5-TETRAHYDRO-1-BENZOXEPIN-5-AMINE |
MDL Number.: | MFCD12181710 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc2c(c(c1)I)OCCCC2N |
InChi: | InChI=1S/C10H12INO/c11-8-4-1-3-7-9(12)5-2-6-13-10(7)8/h1,3-4,9H,2,5-6,12H2 |
InChiKey: | InChIKey=BOHNQSILLGTGQU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.