* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HEPTANE-1,2-DIAMINE |
| English Synonyms: | HEPTANE-1,2-DIAMINE |
| MDL Number.: | MFCD12190232 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | CCCCCC(CN)N |
| InChi: | InChI=1S/C7H18N2/c1-2-3-4-5-7(9)6-8/h7H,2-6,8-9H2,1H3 |
| InChiKey: | InChIKey=PGGXMTDBCVGBLO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.