* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-NITRO-9H-CARBAZOLE |
CAS: | 31438-20-7 |
English Synonyms: | 9-NITRO-9H-CARBAZOLE |
MDL Number.: | MFCD12198366 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)c3ccccc3n2[N+](=O)[O-] |
InChi: | InChI=1S/C12H8N2O2/c15-14(16)13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8H |
InChiKey: | InChIKey=XDUOEJJXLKICFF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.