* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX110016 |
English Synonyms: | WUXIAPPTEC WX110016 |
MDL Number.: | MFCD12198667 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1C[C@H]2CN(CC[C@]2(C1)C(=O)O)C(=O)OCc3ccccc3 |
InChi: | InChI=1S/C21H28N2O6/c1-20(2,3)29-19(27)23-12-16-11-22(10-9-21(16,14-23)17(24)25)18(26)28-13-15-7-5-4-6-8-15/h4-8,16H,9-14H2,1-3H3,(H,24,25)/t16-,21-/m1/s1 |
InChiKey: | InChIKey=DSOPMVAOZWNVRM-IIBYNOLFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.