* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX110063 |
English Synonyms: | WUXIAPPTEC WX110063 |
MDL Number.: | MFCD12198711 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1C[C@H]2CCNC(=O)[C@@H]2C1 |
InChi: | InChI=1S/C12H20N2O3/c1-12(2,3)17-11(16)14-6-8-4-5-13-10(15)9(8)7-14/h8-9H,4-7H2,1-3H3,(H,13,15)/t8-,9-/m1/s1 |
InChiKey: | InChIKey=UGRDCDSOKKHHIV-RKDXNWHRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.